From 32716d6b1e8a90cbe61b60994323029ec6abe85c Mon Sep 17 00:00:00 2001
From: Matthias Melcher <fltk@matthiasm.com>
Date: Sat, 10 Jul 2010 09:44:45 +0000
Subject: Updated the Fluid IDE support for the current source file structure.
 Changed the Fl_Tree rendering code around a bit to make the tree more like
 MSWindows on Windows and more like Apple on Apple machines. I hope you guys
 like it. I also moved the function to load Fl_Preferences into an Fl_Tree
 into the Fl_Tree class where it belongs.

git-svn-id: file:///fltk/svn/fltk/branches/branch-1.3@7672 ea41ed52-d2ee-0310-a9c1-e6b18d33e121
---
 src/Fl_Tree_Prefs.cxx | 44 ++++++++++++++++++++++++++++++++++++++++++--
 1 file changed, 42 insertions(+), 2 deletions(-)

(limited to 'src/Fl_Tree_Prefs.cxx')

diff --git a/src/Fl_Tree_Prefs.cxx b/src/Fl_Tree_Prefs.cxx
index 4adee203d..04afda404 100644
--- a/src/Fl_Tree_Prefs.cxx
+++ b/src/Fl_Tree_Prefs.cxx
@@ -34,6 +34,22 @@
 //    These can be replaced via prefs.openicon()/closeicon()
 //
 static const char *L_open_xpm[] = {
+#ifdef __APPLE__
+  "11 11 2 1",
+  ".  c None",
+  "@  c #000000",
+  "...@.......",
+  "...@@......",
+  "...@@@.....",
+  "...@@@@....",
+  "...@@@@@...",
+  "...@@@@@@..",
+  "...@@@@@...",
+  "...@@@@....",
+  "...@@@.....",
+  "...@@......",
+  "...@......."
+#else
   "11 11 3 1",
   ".	c #fefefe",
   "#	c #444444",
@@ -48,10 +64,28 @@ static const char *L_open_xpm[] = {
   "#....@....#",
   "#.........#",
   "#.........#",
-  "###########"};
+  "###########"
+#endif
+};
 static Fl_Pixmap L_openpixmap(L_open_xpm);
 
 static const char *L_close_xpm[] = {
+#ifdef __APPLE__
+  "11 11 2 1",
+  ".  c None",
+  "@  c #000000",
+  "...........",
+  "...........",
+  "...........",
+  "...........",
+  "...........",
+  "@@@@@@@@@@@",
+  ".@@@@@@@@@.",
+  "..@@@@@@@..",
+  "...@@@@@...",
+  "....@@@....",
+  ".....@....."
+#else
   "11 11 3 1",
   ".	c #fefefe",
   "#	c #444444",
@@ -66,7 +100,9 @@ static const char *L_close_xpm[] = {
   "#.........#",
   "#.........#",
   "#.........#",
-  "###########"};
+  "###########"
+#endif
+};
 static Fl_Pixmap L_closepixmap(L_close_xpm);
 
 /// Sets the default icon to be used as the 'open' icon
@@ -105,7 +141,11 @@ Fl_Tree_Prefs::Fl_Tree_Prefs() {
   _selectcolor            = FL_DARK_BLUE;
   _inactivecolor          = FL_GRAY;
   _connectorcolor         = Fl_Color(43);
+#ifdef __APPLE__
+  _connectorstyle         = FL_TREE_CONNECTOR_NONE;
+#else
   _connectorstyle         = FL_TREE_CONNECTOR_DOTTED;
+#endif
   _openimage              = &L_openpixmap;
   _closeimage             = &L_closepixmap;
   _userimage              = 0;
-- 
cgit v1.2.3