diff options
| author | Matthias Melcher <fltk@matthiasm.com> | 2010-07-10 09:44:45 +0000 |
|---|---|---|
| committer | Matthias Melcher <fltk@matthiasm.com> | 2010-07-10 09:44:45 +0000 |
| commit | 32716d6b1e8a90cbe61b60994323029ec6abe85c (patch) | |
| tree | 9c047f9cbf6a6581ef408dfabdab0aebde240a1b | |
| parent | 8306c3d0b31d4e60a9ba9c4d0ca4ed6a32226de1 (diff) | |
Updated the Fluid IDE support for the current source file structure. Changed the Fl_Tree rendering code around a bit to make the tree more like MSWindows on Windows and more like Apple on Apple machines. I hope you guys like it. I also moved the function to load Fl_Preferences into an Fl_Tree into the Fl_Tree class where it belongs.
git-svn-id: file:///fltk/svn/fltk/branches/branch-1.3@7672 ea41ed52-d2ee-0310-a9c1-e6b18d33e121
| -rw-r--r-- | FL/Fl_Input_.H | 2 | ||||
| -rw-r--r-- | FL/Fl_Preferences.H | 3 | ||||
| -rw-r--r-- | FL/Fl_Tree.H | 2 | ||||
| -rw-r--r-- | Makefile | 2 | ||||
| -rw-r--r-- | fltk.db | 43 | ||||
| -rw-r--r-- | fluid/ide_support.cxx | 4 | ||||
| -rw-r--r-- | ide/VisualC6/fltk.dsw | 3 | ||||
| -rw-r--r-- | ide/VisualC6/tree.dsp | 31 | ||||
| -rw-r--r-- | ide/Xcode3/FLTK.xcodeproj/project.pbxproj | 41 | ||||
| -rw-r--r-- | src/Fl_File_Chooser2.cxx | 2 | ||||
| -rw-r--r-- | src/Fl_Input_.cxx | 6 | ||||
| -rw-r--r-- | src/Fl_Preferences.cxx | 33 | ||||
| -rw-r--r-- | src/Fl_Text_Buffer.cxx | 2 | ||||
| -rw-r--r-- | src/Fl_Tree.cxx | 51 | ||||
| -rw-r--r-- | src/Fl_Tree_Item.cxx | 23 | ||||
| -rw-r--r-- | src/Fl_Tree_Prefs.cxx | 44 | ||||
| -rw-r--r-- | test/demo.cxx | 2 | ||||
| -rw-r--r-- | test/tree.cxx | 96 | ||||
| -rw-r--r-- | test/tree.fl | 107 | ||||
| -rw-r--r-- | test/tree.h | 3 |
20 files changed, 361 insertions, 139 deletions
diff --git a/FL/Fl_Input_.H b/FL/Fl_Input_.H index e93dd4c13..24bb641d4 100644 --- a/FL/Fl_Input_.H +++ b/FL/Fl_Input_.H @@ -151,7 +151,7 @@ class FL_EXPORT Fl_Input_ : public Fl_Widget { /** \internal Horizontal cursor position in pixels while movin up or down. */ static double up_down_pos; - /** \internal Flag to remeber last cursor move. */ + /** \internal Flag to remember last cursor move. */ static int was_up_down; /* Convert a given text segment into the text that will be rendered on screen. */ diff --git a/FL/Fl_Preferences.H b/FL/Fl_Preferences.H index 5d48ceef9..49d66247e 100644 --- a/FL/Fl_Preferences.H +++ b/FL/Fl_Preferences.H @@ -156,7 +156,7 @@ public: // char export( const char *filename, Type fileFormat ); // char import( const char *filename ); - char copyTo(class Fl_Tree*); + // char copyTo(class Fl_Tree*); // deprecated, use Fl_Tree::load(Fl_Preferences&) /** 'Name' provides a simple method to create numerical or more complex @@ -227,7 +227,6 @@ private: public: Node( const char *path ); ~Node(); - char copyTo(class Fl_Tree*, class Fl_Tree_Item*); // node methods int write( FILE *f ); const char *name(); diff --git a/FL/Fl_Tree.H b/FL/Fl_Tree.H index c365d1ae8..be309c81f 100644 --- a/FL/Fl_Tree.H +++ b/FL/Fl_Tree.H @@ -688,6 +688,8 @@ public: void selectmode(Fl_Tree_Select val) { _prefs.selectmode(val); } + + void load(class Fl_Preferences&); }; #endif /*FL_TREE_H*/ @@ -3,7 +3,7 @@ # # Top-level makefile for the Fast Light Tool Kit (FLTK). # -# Copyright 1998-2009 by Bill Spitzak and others. +# Copyright 1998-2010 by Bill Spitzak and others. # # This library is free software; you can redistribute it and/or # modify it under the terms of the GNU Library General Public @@ -932,6 +932,7 @@ xcBuildFileID:9DD7A2B6D63D30C07781F446 refUUID:81A99CD2-985D-4B34-A385-DA2DF36B25C7 (filename):src/Fl_Paged_Device.cxx +xcBuildFileID:299CB8A2848CB844BCEC7829 [./targets/libs/FCA55664-7065-436F-B7F2-7F7A397ED739/headers] @@ -1290,12 +1291,6 @@ refUUID:A3D03C3D-FB0C-4D14-8AF8-96086624A44E (filename):FL/Fl_Overlay_Window.H xcCopyHeaderID:012DC7566408D3CBF672BE50 -[./targets/libs/FCA55664-7065-436F-B7F2-7F7A397ED739/headers/E4711E48-2B85-4DAB-BB3B-9DDCBD7C9160] - -refUUID:E2A26BE4-534B-4B50-AA6F-D28A7BF13F54 -(filename):FL/Fl_PSfile_Device.H -xcCopyHeaderID:13B77D5A401B98BD18D3CCF8 - [./targets/libs/FCA55664-7065-436F-B7F2-7F7A397ED739/headers/405F4A61-8DD8-423C-938C-FA24D4E451AD] refUUID:A59BDACF-075D-4E17-8BE8-38E0E7A51003 @@ -1702,6 +1697,7 @@ xcCopyHeaderID:72843BB6450DBFB9A9F53490 refUUID:D7271ED9-045A-4F82-A493-3717A1B0D3AE (filename):FL/Fl_Paged_Device.H +xcCopyHeaderID:7582831EE62557F2D4668FA4 [./targets/libs/FCA55664-7065-436F-B7F2-7F7A397ED739/externals] @@ -7629,12 +7625,6 @@ xcBuildConfigurationReleaseID:9E23AA974E99E89DC5E46D9F [./targets/tests/9CE11918-3DC2-4650-B91B-28BABE55E182/sources] -[./targets/tests/9CE11918-3DC2-4650-B91B-28BABE55E182/sources/2AA033DE-7570-445E-B0B8-B2695B27BC68] - -refUUID:5684BCF0-9061-4396-A4F5-1E8E633F716B -(filename):test/tree.cxx -xcBuildFileID:8B1319F9AB1424C1480A3133 - [./targets/tests/9CE11918-3DC2-4650-B91B-28BABE55E182/deps] @@ -7644,6 +7634,12 @@ refUUID:FCA55664-7065-436F-B7F2-7F7A397ED739 xcProxyID:02A677752D704FC1308C2C01 xcDependencyID:89EEA83A9CD9747F05B1E6AA +[./targets/tests/9CE11918-3DC2-4650-B91B-28BABE55E182/deps/14C691AE-415D-4273-98F0-43175A8B54E6] + +refUUID:D70F995E-DA2E-46A4-9F93-90D4F6C7DE87 +xcProxyID:14AFCE90907C6F3225151910 +xcDependencyID:9519279882836E4B8EDEBE60 + [./targets/tests/9CE11918-3DC2-4650-B91B-28BABE55E182/libs] @@ -7659,6 +7655,12 @@ xcCopyFrameworkID:F1C6FA1ABFEFA9DD53A7B8E8 [./targets/tests/9CE11918-3DC2-4650-B91B-28BABE55E182/fl] +[./targets/tests/9CE11918-3DC2-4650-B91B-28BABE55E182/fl/93140A57-AA6D-46BC-972D-8ADAED12A7A8] + +refUUID:9ABC95B6-DEE6-4145-8EBA-A4D2CF1DC7CF +(filename):test/tree.fl +xcBuildFileID:16FC08C22B1B693EB00C15F5 + [./targets/tests/9CE11918-3DC2-4650-B91B-28BABE55E182/externals] @@ -8815,11 +8817,6 @@ xcFileID:D585CB55BDA143D343033352 pathAndName:FL/Fl_Overlay_Window.H xcFileID:1FCDDD4E00F7CAA8193CAE04 -[./files/E2A26BE4-534B-4B50-AA6F-D28A7BF13F54] - -pathAndName:FL/Fl_PSfile_Device.H -xcFileID:44C10E7FA85430F4E1D68B60 - [./files/A59BDACF-075D-4E17-8BE8-38E0E7A51003] pathAndName:FL/Fl_Pack.H @@ -10290,11 +10287,6 @@ xcFileID:0DFF833B9E81E11FA3E3A85A pathAndName:test/tiled_image.cxx xcFileID:94D15578CD49CC75FE6617E4 -[./files/5684BCF0-9061-4396-A4F5-1E8E633F716B] - -pathAndName:test/tree.cxx -xcFileID:ECCD42A2E7B2C6BF5B3DF410 - [./files/7FB34E60-5136-423E-AD80-56CF9ABABE15] pathAndName:test/utf8.cxx @@ -10313,10 +10305,17 @@ xcFileID:48A8DC166D69EDC6F24AE678 [./files/81A99CD2-985D-4B34-A385-DA2DF36B25C7] pathAndName:src/Fl_Paged_Device.cxx +xcFileID:6C1C9A4F054C48CDD6A2DE44 [./files/D7271ED9-045A-4F82-A493-3717A1B0D3AE] pathAndName:FL/Fl_Paged_Device.H +xcFileID:4CABCBB89F9DD5CF57BB9779 + +[./files/9ABC95B6-DEE6-4145-8EBA-A4D2CF1DC7CF] + +pathAndName:test/tree.fl +xcFileID:D10B1EA053B5C8F02A636D93 [./ide] diff --git a/fluid/ide_support.cxx b/fluid/ide_support.cxx index 65a55e83b..ea3dd0d57 100644 --- a/fluid/ide_support.cxx +++ b/fluid/ide_support.cxx @@ -571,7 +571,6 @@ int create_new_database(const char *filename) fltk_lib.add_header(files_db, "FL/Fl_Object.H"); fltk_lib.add_header(files_db, "FL/Fl_Output.H"); fltk_lib.add_header(files_db, "FL/Fl_Overlay_Window.H"); - fltk_lib.add_header(files_db, "FL/Fl_PSfile_Device.H"); fltk_lib.add_header(files_db, "FL/Fl_Pack.H"); fltk_lib.add_header(files_db, "FL/Fl_Paged_Device.H"); fltk_lib.add_header(files_db, "FL/Fl_Pixmap.H"); @@ -1324,8 +1323,9 @@ int create_new_database(const char *filename) } { Fl_Target_Prefs db(tests_db.add_with_key("name", "tree")); - db.add_source(files_db, "test/tree.cxx"); + db.add_fl(files_db, "test/tree.fl"); db.add_lib(fltk_lib); + db.depends_on(fluid_app); demo_db.depends_on(db); } diff --git a/ide/VisualC6/fltk.dsw b/ide/VisualC6/fltk.dsw index 6b0a9b29e..c121e3284 100644 --- a/ide/VisualC6/fltk.dsw +++ b/ide/VisualC6/fltk.dsw @@ -1586,6 +1586,9 @@ Package=<4> Begin Project Dependency
Project_Dep_Name fltk
End Project Dependency
+ Begin Project Dependency
+ Project_Dep_Name Fluid
+ End Project Dependency
}}}
###############################################################################
diff --git a/ide/VisualC6/tree.dsp b/ide/VisualC6/tree.dsp index a5a867933..eab7cb60f 100644 --- a/ide/VisualC6/tree.dsp +++ b/ide/VisualC6/tree.dsp @@ -93,5 +93,36 @@ LINK32=link.exe SOURCE=..\..\test\tree.cxx
# End Source File
+# Begin Source File
+
+SOURCE=..\..\test\tree.fl
+
+!IF "$(CFG)" == "tree - Win32 Release"
+
+# Begin Custom Build - Create .cxx and .h file with fluid
+InputPath=..\..\test\tree.fl
+
+"..\..\test\tree.cxx" : $(SOURCE) "$(INTDIR)" "$(OUTDIR)"
+ cd ..\..\test/
+ ..\fluid\fluid -c tree.fl
+ cd ..\ide\visualc
+
+# End Custom Build
+
+!ELSEIF "$(CFG)" == "tree - Win32 Debug"
+
+# Begin Custom Build - Create .cxx and .h file with fluidd
+InputPath=..\..\test\tree.fl
+
+"..\..\test\tree.cxx" : $(SOURCE) "$(INTDIR)" "$(OUTDIR)"
+ cd ..\..\test/
+ ..\fluid\fluidd -c tree.fl
+ cd ..\ide\visualc
+
+# End Custom Build
+
+!ENDIF
+
+# End Source File
# End Target
# End Project
diff --git a/ide/Xcode3/FLTK.xcodeproj/project.pbxproj b/ide/Xcode3/FLTK.xcodeproj/project.pbxproj index 5458904dc..a82aa48dd 100644 --- a/ide/Xcode3/FLTK.xcodeproj/project.pbxproj +++ b/ide/Xcode3/FLTK.xcodeproj/project.pbxproj @@ -60,7 +60,6 @@ 12E4293A141DD684369D6B8F /* fl_boxtype.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 9B54C6B8D801E899981FC5E6 /* fl_boxtype.cxx */; }; 12EDA8498FE1A47E32A9428E /* png.c in Sources */ = {isa = PBXBuildFile; fileRef = 5575DA9A654EB53C515F917A /* png.c */; }; 1328D9EE314856BAB7A54D5A /* Fl_BMP_Image.H in Headers */ = {isa = PBXBuildFile; fileRef = B20D11CF3F871C99011F632E /* Fl_BMP_Image.H */; settings = {ATTRIBUTES = (Public, ); }; }; - 13B77D5A401B98BD18D3CCF8 /* Fl_PSfile_Device.H in Headers */ = {isa = PBXBuildFile; fileRef = 44C10E7FA85430F4E1D68B60 /* Fl_PSfile_Device.H */; settings = {ATTRIBUTES = (Public, ); }; }; 13DE96EAB36238A478381098 /* fltk.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = FEB0F8FE6383384180570D94 /* fltk.framework */; }; 1490AC534F76E26EF9280C6D /* Fl_add_idle.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 274CBEBF1D1BFD5C91605CBE /* Fl_add_idle.cxx */; }; 1565219A0166F42F299C2C9E /* Fl_Browser_load.cxx in Sources */ = {isa = PBXBuildFile; fileRef = E46A3C4F955A94AE095FF726 /* Fl_Browser_load.cxx */; }; @@ -68,6 +67,7 @@ 16C76FAEEC543074798FF0CB /* fltk.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = FEB0F8FE6383384180570D94 /* fltk.framework */; }; 16CA21C97F278A00B2558C3C /* pngread.c in Sources */ = {isa = PBXBuildFile; fileRef = C4CF7DDC2EC8792157A3F43B /* pngread.c */; }; 16F26F7D137CC7F7B57ECAC0 /* fltk_zlib.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = F8880CD3FEF32388A24C1B94 /* fltk_zlib.framework */; }; + 16FC08C22B1B693EB00C15F5 /* tree.fl in Sources */ = {isa = PBXBuildFile; fileRef = D10B1EA053B5C8F02A636D93 /* tree.fl */; }; 17875FB347705D46D333E6EC /* fractals.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 598DD70F89D7731D61BBD8EF /* fractals.cxx */; }; 180F08AFCDEE94081FDCD9AF /* Fl_Choice.H in Headers */ = {isa = PBXBuildFile; fileRef = C8AE10A8DDF53B8B27E3215A /* Fl_Choice.H */; settings = {ATTRIBUTES = (Public, ); }; }; 185933E619D6C024C4B53D3B /* Fl_Value_Input.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 34CB383C3A4360C14B58562E /* Fl_Value_Input.cxx */; }; @@ -129,9 +129,9 @@ 2800B0509A5D20FABE8F02DC /* fl_show_colormap.cxx in Sources */ = {isa = PBXBuildFile; fileRef = EB15CE98189A4C0A7A8A480F /* fl_show_colormap.cxx */; }; 2832E97111DB41A4B13A4EFE /* keyboard_ui.fl in Sources */ = {isa = PBXBuildFile; fileRef = 7B084447C58E292798B27283 /* keyboard_ui.fl */; }; 285B384349B0FC5FCE9C9FCE /* fl_open_uri.cxx in Sources */ = {isa = PBXBuildFile; fileRef = FAD24127A06F3F9F0EEB843A /* fl_open_uri.cxx */; }; - 28A5D2BB72720891608E7B82 /* Fl_Abstract_Printer.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 5E009E15C14AA1D60827722D /* Fl_Abstract_Printer.cxx */; }; 291FA24A9E91A2036BC718A2 /* Fl_Overlay_Window.cxx in Sources */ = {isa = PBXBuildFile; fileRef = D1C792936D427CC48581BFAE /* Fl_Overlay_Window.cxx */; }; 29303C4480E0BBEB9E29EE7B /* vsnprintf.c in Sources */ = {isa = PBXBuildFile; fileRef = EBC0D2C965EDD6503B0CF519 /* vsnprintf.c */; }; + 299CB8A2848CB844BCEC7829 /* Fl_Paged_Device.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 6C1C9A4F054C48CDD6A2DE44 /* Fl_Paged_Device.cxx */; }; 29A99477531233BE9391CE66 /* Fl_Slider.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 5AF5119D08DFC92EA1032671 /* Fl_Slider.cxx */; }; 29B01C1F3FF6C5B007DEEF45 /* fltk.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = FEB0F8FE6383384180570D94 /* fltk.framework */; }; 29ED282EF51CBBB0CDEE76D6 /* Fl_Color_Chooser.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 058BCBC36ADE724A418F1C43 /* Fl_Color_Chooser.cxx */; }; @@ -368,6 +368,7 @@ 74D195DEE3A33FA0C8C7A5BE /* Fl_Help_View.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 790419B5A0AD64D66F9B19E1 /* Fl_Help_View.cxx */; }; 74D5FD7ED2AF3F51D8B2EEEB /* Fl_Slider.H in Headers */ = {isa = PBXBuildFile; fileRef = F2E5612A81A6E8D53ED91CAE /* Fl_Slider.H */; settings = {ATTRIBUTES = (Public, ); }; }; 753A6417598E2D35C308632A /* valuators.fl in Sources */ = {isa = PBXBuildFile; fileRef = 590C56F672356072A5C86BC3 /* valuators.fl */; }; + 7582831EE62557F2D4668FA4 /* Fl_Paged_Device.H in Headers */ = {isa = PBXBuildFile; fileRef = 4CABCBB89F9DD5CF57BB9779 /* Fl_Paged_Device.H */; settings = {ATTRIBUTES = (Public, ); }; }; 761829645FD3BCA7EE9DE369 /* fltk_gl.framework in CopyFiles */ = {isa = PBXBuildFile; fileRef = EA8E6EC230301E597B9D9AED /* fltk_gl.framework */; }; 762325B25679668EB687A028 /* gl_overlay.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 1F6E4CE3C0DF58D8F7B3A94A /* gl_overlay.cxx */; }; 76BA5F2997A55DDFA04EFC98 /* ide_visualc.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 9C0598A21FEE02AA4F0E39C9 /* ide_visualc.cxx */; }; @@ -430,7 +431,6 @@ 8A80E9D910324212101C3E76 /* fltk.framework in CopyFiles */ = {isa = PBXBuildFile; fileRef = FEB0F8FE6383384180570D94 /* fltk.framework */; }; 8AB3C564389AED897174FFF2 /* Fl_Type.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 0B800D01D215C41573FFE4DA /* Fl_Type.cxx */; }; 8AC8FF5C9534F6E0664A352B /* fltk.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = FEB0F8FE6383384180570D94 /* fltk.framework */; }; - 8B1319F9AB1424C1480A3133 /* tree.cxx in Sources */ = {isa = PBXBuildFile; fileRef = ECCD42A2E7B2C6BF5B3DF410 /* tree.cxx */; }; 8BA3F05B96804E0FD9491049 /* fltk.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = FEB0F8FE6383384180570D94 /* fltk.framework */; }; 8CC2898FB12015F247784420 /* jdcoefct.c in Sources */ = {isa = PBXBuildFile; fileRef = A715D265EAD3C5DA5628485C /* jdcoefct.c */; }; 8CCF18F146F2012A0C1DC330 /* Fl_Return_Button.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 9A3D4184FF1C89B7CEE9FBD6 /* Fl_Return_Button.cxx */; }; @@ -568,7 +568,6 @@ BCFD2D2C8ED191EFB52166A4 /* fl_show_input.H in Headers */ = {isa = PBXBuildFile; fileRef = EFAE92A1C7CA90BC56E5A70A /* fl_show_input.H */; settings = {ATTRIBUTES = (Public, ); }; }; BD48B8B0B3DE04E72A17F60D /* jdmarker.c in Sources */ = {isa = PBXBuildFile; fileRef = BB37899B104B362F32F0F417 /* jdmarker.c */; }; BDB3A4C9B2AC519DC6A95D84 /* fl_dnd.cxx in Sources */ = {isa = PBXBuildFile; fileRef = 2DD93178E8AFA850DAC293FC /* fl_dnd.cxx */; }; - BE079BCB8B1142B84067555A /* Fl_Abstract_Printer.H in Headers */ = {isa = PBXBuildFile; fileRef = F9AAAD5964050A3DC9E20879 /* Fl_Abstract_Printer.H */; settings = {ATTRIBUTES = (Public, ); }; }; BF212FE1FA8676E379DE4BC1 /* fltk_gl.framework in CopyFiles */ = {isa = PBXBuildFile; fileRef = EA8E6EC230301E597B9D9AED /* fltk_gl.framework */; }; BF3BDB0B4DA065027B4771CA /* fltk.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = FEB0F8FE6383384180570D94 /* fltk.framework */; }; BF7219C14C522420ED920D72 /* Fl_Simple_Counter.H in Headers */ = {isa = PBXBuildFile; fileRef = 9B57B581401BD8575BFAF2F1 /* Fl_Simple_Counter.H */; settings = {ATTRIBUTES = (Public, ); }; }; @@ -1785,6 +1784,13 @@ remoteGlobalIDString = A57FDE871C99A52BEEDEE68C; remoteInfo = fltk; }; + 14AFCE90907C6F3225151910 /* PBXContainerItemProxy */ = { + isa = PBXContainerItemProxy; + containerPortal = 4BF1A7FFEACF5F31B4127482 /* Project object */; + proxyType = 1; + remoteGlobalIDString = AE6BC0AEB24EBBBDBA4071E0; + remoteInfo = Fluid; + }; 16BBABAD50B4194D5D76302F /* PBXContainerItemProxy */ = { isa = PBXContainerItemProxy; containerPortal = 4BF1A7FFEACF5F31B4127482 /* Project object */; @@ -3947,7 +3953,6 @@ 43D9A7CD936B1382F5EA23E1 /* about_panel.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = about_panel.cxx; path = ../../fluid/about_panel.cxx; sourceTree = SOURCE_ROOT; }; 44277061B27BFBE1FB22B79B /* menubar.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = menubar.cxx; path = ../../test/menubar.cxx; sourceTree = SOURCE_ROOT; }; 44B6E71105CCEECB4D5E2DC8 /* ide_support.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = ide_support.h; path = ../../fluid/ide_support.h; sourceTree = SOURCE_ROOT; }; - 44C10E7FA85430F4E1D68B60 /* Fl_PSfile_Device.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_PSfile_Device.H; path = ../../FL/Fl_PSfile_Device.H; sourceTree = SOURCE_ROOT; }; 451D01896EFDD83277515630 /* glut.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = glut.H; path = ../../FL/glut.H; sourceTree = SOURCE_ROOT; }; 4577F046D6D5D93D2553BFBC /* jdtrans.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = jdtrans.c; path = ../../jpeg/jdtrans.c; sourceTree = SOURCE_ROOT; }; 45B993D3FA0EED6037499D3A /* color_chooser.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = color_chooser.cxx; path = ../../test/color_chooser.cxx; sourceTree = SOURCE_ROOT; }; @@ -3965,6 +3970,7 @@ 4C2979BC9629FABDCC0271BB /* jcmainct.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = jcmainct.c; path = ../../jpeg/jcmainct.c; sourceTree = SOURCE_ROOT; }; 4C2EEE3E17025A63A0AEEF5F /* hello.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = hello.cxx; path = ../../test/hello.cxx; sourceTree = SOURCE_ROOT; }; 4C9AF6F2C1B78A67FFD177F9 /* gl2opengl.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = gl2opengl.h; path = ../../FL/gl2opengl.h; sourceTree = SOURCE_ROOT; }; + 4CABCBB89F9DD5CF57BB9779 /* Fl_Paged_Device.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Paged_Device.H; path = ../../FL/Fl_Paged_Device.H; sourceTree = SOURCE_ROOT; }; 4CD4094D8712818EACF5C7C5 /* Fl_Progress.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Progress.H; path = ../../FL/Fl_Progress.H; sourceTree = SOURCE_ROOT; }; 4CD5A5D2975A2CCB77EBAD43 /* jutils.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = jutils.c; path = ../../jpeg/jutils.c; sourceTree = SOURCE_ROOT; }; 4D124BD72F4E63D99837CE0C /* fl_encoding_latin1.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = fl_encoding_latin1.cxx; path = ../../src/fl_encoding_latin1.cxx; sourceTree = SOURCE_ROOT; }; @@ -4005,7 +4011,6 @@ 5CDA214AEABC15E3EF1BB172 /* Fl_Adjuster.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Adjuster.H; path = ../../FL/Fl_Adjuster.H; sourceTree = SOURCE_ROOT; }; 5CE4CB9AEF9070A32A27696D /* fl_overlay_visual.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = fl_overlay_visual.cxx; path = ../../src/fl_overlay_visual.cxx; sourceTree = SOURCE_ROOT; }; 5D36F806A2C72F1894F0878E /* Fl_File_Icon.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Fl_File_Icon.cxx; path = ../../src/Fl_File_Icon.cxx; sourceTree = SOURCE_ROOT; }; - 5E009E15C14AA1D60827722D /* Fl_Abstract_Printer.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Fl_Abstract_Printer.cxx; path = ../../src/Fl_Abstract_Printer.cxx; sourceTree = SOURCE_ROOT; }; 5E0EC227A972D2E4F34A2CEB /* Fl_Tree.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Tree.H; path = ../../FL/Fl_Tree.H; sourceTree = SOURCE_ROOT; }; 5EF025FDE53B2276B6931CD5 /* clock.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = clock.cxx; path = ../../test/clock.cxx; sourceTree = SOURCE_ROOT; }; 5F328DFEE7B768CF141C8E9E /* zutil.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = zutil.c; path = ../../zlib/zutil.c; sourceTree = SOURCE_ROOT; }; @@ -4033,6 +4038,7 @@ 6B30F6EA5CA69E305D2B82EE /* is_right2left.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = is_right2left.c; path = ../../src/xutf8/is_right2left.c; sourceTree = SOURCE_ROOT; }; 6BCDA929CD8600DE9AC516DD /* compress.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = compress.c; path = ../../zlib/compress.c; sourceTree = SOURCE_ROOT; }; 6BDBE905BDAC3374782D6E81 /* input.app */ = {isa = PBXFileReference; explicitFileType = wrapper.application; includeInIndex = 0; path = input.app; sourceTree = BUILT_PRODUCTS_DIR; }; + 6C1C9A4F054C48CDD6A2DE44 /* Fl_Paged_Device.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Fl_Paged_Device.cxx; path = ../../src/Fl_Paged_Device.cxx; sourceTree = SOURCE_ROOT; }; 6C64353A3129BCCFAA667D86 /* boxtype.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = boxtype.cxx; path = ../../test/boxtype.cxx; sourceTree = SOURCE_ROOT; }; 6CCA5064754A8314839CB37A /* freeglut_stroke_roman.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = freeglut_stroke_roman.cxx; path = ../../src/freeglut_stroke_roman.cxx; sourceTree = SOURCE_ROOT; }; 6D999C03407EAEE9C4D3477A /* browser.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = browser.cxx; path = ../../test/browser.cxx; sourceTree = SOURCE_ROOT; }; @@ -4257,6 +4263,7 @@ D02CF2893ECCE831CD5D3176 /* Fl_Multi_Label.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Fl_Multi_Label.cxx; path = ../../src/Fl_Multi_Label.cxx; sourceTree = SOURCE_ROOT; }; D06E371A971A3BC1B399AD78 /* button.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = button.cxx; path = ../../test/button.cxx; sourceTree = SOURCE_ROOT; }; D0E376E93B4F22BE701D29E0 /* Fl_Roller.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Fl_Roller.cxx; path = ../../src/Fl_Roller.cxx; sourceTree = SOURCE_ROOT; }; + D10B1EA053B5C8F02A636D93 /* tree.fl */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.fluid; name = tree.fl; path = ../../test/tree.fl; sourceTree = SOURCE_ROOT; }; D1C792936D427CC48581BFAE /* Fl_Overlay_Window.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Fl_Overlay_Window.cxx; path = ../../src/Fl_Overlay_Window.cxx; sourceTree = SOURCE_ROOT; }; D2DE1079C826533A91053A9C /* Fl_XBM_Image.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_XBM_Image.H; path = ../../FL/Fl_XBM_Image.H; sourceTree = SOURCE_ROOT; }; D33C668435685F7CCB359EE2 /* pngrio.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = pngrio.c; path = ../../png/pngrio.c; sourceTree = SOURCE_ROOT; }; @@ -4336,7 +4343,6 @@ EC2BAEE540612218DC9EEC75 /* Fl_Scroll.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Scroll.H; path = ../../FL/Fl_Scroll.H; sourceTree = SOURCE_ROOT; }; EC57889382FB898FD3EF2580 /* Fl_Gl_Window.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Fl_Gl_Window.cxx; path = ../../src/Fl_Gl_Window.cxx; sourceTree = SOURCE_ROOT; }; EC5862E1FC79542DC55D8462 /* colbrowser.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = colbrowser.cxx; path = ../../test/colbrowser.cxx; sourceTree = SOURCE_ROOT; }; - ECCD42A2E7B2C6BF5B3DF410 /* tree.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = tree.cxx; path = ../../test/tree.cxx; sourceTree = SOURCE_ROOT; }; ECFF712363202EC351A51E53 /* Fl_PNM_Image.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Fl_PNM_Image.cxx; path = ../../src/Fl_PNM_Image.cxx; sourceTree = SOURCE_ROOT; }; EDCB878D48197F6AE1C99614 /* jidctred.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = jidctred.c; path = ../../jpeg/jidctred.c; sourceTree = SOURCE_ROOT; }; EDE6CE6B09D31AC0AAC9FF56 /* fullscreen.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = fullscreen.cxx; path = ../../test/fullscreen.cxx; sourceTree = SOURCE_ROOT; }; @@ -4366,7 +4372,6 @@ F8BAA8B283D4CF4D904B6486 /* Fl_Valuator.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Valuator.H; path = ../../FL/Fl_Valuator.H; sourceTree = SOURCE_ROOT; }; F91DEF40DC3592BE52CAB001 /* Fl_Native_File_Chooser.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Native_File_Chooser.H; path = ../../FL/Fl_Native_File_Chooser.H; sourceTree = SOURCE_ROOT; }; F98FE04C081FB5B1161C546C /* Fl_Window.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Window.H; path = ../../FL/Fl_Window.H; sourceTree = SOURCE_ROOT; }; - F9AAAD5964050A3DC9E20879 /* Fl_Abstract_Printer.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Abstract_Printer.H; path = ../../FL/Fl_Abstract_Printer.H; sourceTree = SOURCE_ROOT; }; FA2F70BA8FF4E7F4B7B36971 /* fl_file_dir.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = fl_file_dir.cxx; path = ../../src/fl_file_dir.cxx; sourceTree = SOURCE_ROOT; }; FAA6BA6E4DC1AF28F5FC8466 /* Fl_Tile.H */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.h; name = Fl_Tile.H; path = ../../FL/Fl_Tile.H; sourceTree = SOURCE_ROOT; }; FAD24127A06F3F9F0EEB843A /* fl_open_uri.cxx */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = fl_open_uri.cxx; path = ../../src/fl_open_uri.cxx; sourceTree = SOURCE_ROOT; }; @@ -5154,7 +5159,6 @@ children = ( B04F6E032ADAF0A16A860A2E /* Headers */, F4EFF27D730BED51EF0EAA8D /* Fl.cxx */, - 5E009E15C14AA1D60827722D /* Fl_Abstract_Printer.cxx */, 19C5DB6F3DD5011DAE6F79AB /* Fl_Adjuster.cxx */, 3F000DD5F091F66BC42822E3 /* Fl_Bitmap.cxx */, C3F048573FAEABD2D27401D4 /* Fl_Box.cxx */, @@ -5303,6 +5307,7 @@ FB7A9EFB3C7CDAE324E9544F /* case.c */, 6B30F6EA5CA69E305D2B82EE /* is_right2left.c */, 5AE1F936F1C186E18C1B9C28 /* is_spacing.c */, + 6C1C9A4F054C48CDD6A2DE44 /* Fl_Paged_Device.cxx */, E05754DEC1813B6BA6DC1FC8 /* AudioToolbox.framework */, ); name = fltk; @@ -5420,7 +5425,7 @@ 2DD062AF5E08E6EEAE97E188 /* tree */ = { isa = PBXGroup; children = ( - ECCD42A2E7B2C6BF5B3DF410 /* tree.cxx */, + D10B1EA053B5C8F02A636D93 /* tree.fl */, ); name = tree; sourceTree = "<group>"; @@ -5904,7 +5909,6 @@ children = ( 84CE79448708855561FEE498 /* Enumerations.H */, C359E5D5187606DD69C7938B /* Fl.H */, - F9AAAD5964050A3DC9E20879 /* Fl_Abstract_Printer.H */, 5CDA214AEABC15E3EF1BB172 /* Fl_Adjuster.H */, FE90AA3BB40510FA45E0C27B /* Fl_Bitmap.H */, 390863A4D5D1B4C7C9B58679 /* Fl_Box.H */, @@ -5962,7 +5966,6 @@ EE2FB1F7B99BE408E1B4DFB7 /* Fl_Object.H */, D585CB55BDA143D343033352 /* Fl_Output.H */, 1FCDDD4E00F7CAA8193CAE04 /* Fl_Overlay_Window.H */, - 44C10E7FA85430F4E1D68B60 /* Fl_PSfile_Device.H */, 52C3B1D0A473BDC01D497917 /* Fl_Pack.H */, B8455C1BD96FF6FB3C197C34 /* Fl_Pixmap.H */, A8F89055CABBCFECCC4CC940 /* Fl_Plugin.H */, @@ -6030,6 +6033,7 @@ D5CE28437ABB8513BE08AC77 /* names.h */, 62281FC096BA407C4F1E6824 /* win32.H */, 83CED42A779FA76E98D37CA8 /* x.H */, + 4CABCBB89F9DD5CF57BB9779 /* Fl_Paged_Device.H */, ); name = Headers; sourceTree = "<group>"; @@ -6422,7 +6426,6 @@ files = ( 05D71028D71BB089B3157E35 /* Enumerations.H in Headers */, 0231212CBF1A26721E3F20FE /* Fl.H in Headers */, - BE079BCB8B1142B84067555A /* Fl_Abstract_Printer.H in Headers */, 1EE443C865A80CACB57E4815 /* Fl_Adjuster.H in Headers */, 424ADD12193823093AF1FBDF /* Fl_Bitmap.H in Headers */, E02DABD44EE5FDAC20F3F676 /* Fl_Box.H in Headers */, @@ -6480,7 +6483,6 @@ A9E5239AB84083A21F3F490B /* Fl_Object.H in Headers */, 62CFB49620B17B8938A1063F /* Fl_Output.H in Headers */, 012DC7566408D3CBF672BE50 /* Fl_Overlay_Window.H in Headers */, - 13B77D5A401B98BD18D3CCF8 /* Fl_PSfile_Device.H in Headers */, 3D282039331A6ECDFED5255E /* Fl_Pack.H in Headers */, B9134F6A1769B94761981AEA /* Fl_Pixmap.H in Headers */, 93CC0E443DAAB241C7EEE4B7 /* Fl_Plugin.H in Headers */, @@ -6548,6 +6550,7 @@ D8C2D8F3053EEF229EEF66FB /* names.h in Headers */, 43EF9194502AFF8F5EE968EE /* win32.H in Headers */, 72843BB6450DBFB9A9F53490 /* x.H in Headers */, + 7582831EE62557F2D4668FA4 /* Fl_Paged_Device.H in Headers */, ); runOnlyForDeploymentPostprocessing = 0; }; @@ -8208,6 +8211,7 @@ ); dependencies = ( 89EEA83A9CD9747F05B1E6AA /* PBXTargetDependency */, + 9519279882836E4B8EDEBE60 /* PBXTargetDependency */, ); name = tree; productName = tree; @@ -8991,7 +8995,7 @@ isa = PBXSourcesBuildPhase; buildActionMask = 2147483647; files = ( - 8B1319F9AB1424C1480A3133 /* tree.cxx in Sources */, + 16FC08C22B1B693EB00C15F5 /* tree.fl in Sources */, ); runOnlyForDeploymentPostprocessing = 0; }; @@ -9094,7 +9098,6 @@ buildActionMask = 2147483647; files = ( ED83B85BA678C8C9B5E91535 /* Fl.cxx in Sources */, - 28A5D2BB72720891608E7B82 /* Fl_Abstract_Printer.cxx in Sources */, B371C5FF1106E69056784D6C /* Fl_Adjuster.cxx in Sources */, 274F92CF30A586E0F8E21530 /* Fl_Bitmap.cxx in Sources */, 40E66CBA06083998669F80CE /* Fl_Box.cxx in Sources */, @@ -9243,6 +9246,7 @@ EF0B77D0D7EF375C1CBDC390 /* case.c in Sources */, CE14EC6653D4EF4779992758 /* is_right2left.c in Sources */, 9DD7A2B6D63D30C07781F446 /* is_spacing.c in Sources */, + 299CB8A2848CB844BCEC7829 /* Fl_Paged_Device.cxx in Sources */, ); runOnlyForDeploymentPostprocessing = 0; }; @@ -10253,6 +10257,11 @@ target = 5C2FE9F5E71E04EA903248FA /* input */; targetProxy = 3B38ABA4483E58B2891D08CB /* PBXContainerItemProxy */; }; + 9519279882836E4B8EDEBE60 /* PBXTargetDependency */ = { + isa = PBXTargetDependency; + target = AE6BC0AEB24EBBBDBA4071E0 /* Fluid */; + targetProxy = 14AFCE90907C6F3225151910 /* PBXContainerItemProxy */; + }; 951CA1D37E7F30B53E37B095 /* PBXTargetDependency */ = { isa = PBXTargetDependency; target = A57FDE871C99A52BEEDEE68C /* fltk */; diff --git a/src/Fl_File_Chooser2.cxx b/src/Fl_File_Chooser2.cxx index f7e095e86..33b7e3f2e 100644 --- a/src/Fl_File_Chooser2.cxx +++ b/src/Fl_File_Chooser2.cxx @@ -1031,6 +1031,8 @@ Fl_File_Chooser::filter(const char *p) // I - Pattern(s) if (!allfiles) showChoice->add(all_files_label); showChoice->add(custom_filter_label); + + // TODO: add a menu item to switch hidden files on and off showChoice->value(0); showChoiceCB(); diff --git a/src/Fl_Input_.cxx b/src/Fl_Input_.cxx index 67b9fe709..d39fe62d6 100644 --- a/src/Fl_Input_.cxx +++ b/src/Fl_Input_.cxx @@ -722,12 +722,12 @@ static void undobuffersize(int n) { <tt>when() & FL_WHEN_CHANGED</tt> and there is a change. Set \p b and \p e equal to not delete anything. - Set insert to \c NULL to not insert anything. + Set \p text to \c NULL to not insert anything. - \p ilen must be zero or strlen(insert), this + \p ilen can be zero or <tt>strlen(text)</tt>, which saves a tiny bit of time if you happen to already know the length of the insertion, or can be used to insert a portion of a - string or a string containing <tt>nul</tt>'s. + string. \p b and \p e are clamped to the <tt>0..size()</tt> range, so it is safe to pass any values. diff --git a/src/Fl_Preferences.cxx b/src/Fl_Preferences.cxx index 466a4f5d6..7a5a72b36 100644 --- a/src/Fl_Preferences.cxx +++ b/src/Fl_Preferences.cxx @@ -380,17 +380,6 @@ Fl_Preferences::~Fl_Preferences() /** - Copy the database hierarchy to an Fl_Tree browser from this node down. - */ -char Fl_Preferences::copyTo(Fl_Tree *tree) -{ - if (!tree->root()) - tree->add(name()); - return node->copyTo(tree, tree->root()); -} - - -/** Returns the number of groups that are contained within a group. \return 0 for no groups at all @@ -1762,28 +1751,6 @@ void Fl_Preferences::Node::deleteIndex() { indexed_ = 0; } -char Fl_Preferences::Node::copyTo(Fl_Tree *tree, Fl_Tree_Item *ti) -{ - ti->label(name()); - ti->user_data(this); - Node *nd = child_; - for ( ; nd; nd = nd->next_) { - Fl_Tree_Item *tic = tree->insert(ti, 0, 0); - nd->copyTo(tree, tic); - tic->close(); - } - int i, n = nEntry_; - for (i=0; i<n; i++) { - char buf[80]; - const char *name = entry_[i].name; - const char *value = entry_[i].value; - fl_snprintf(buf, 80, "%s: %s", name, value); - tree->add(ti, buf); - } - return 0; -} - - /** * \brief Create a plugin. * diff --git a/src/Fl_Text_Buffer.cxx b/src/Fl_Text_Buffer.cxx index 5c87340b6..74e04688a 100644 --- a/src/Fl_Text_Buffer.cxx +++ b/src/Fl_Text_Buffer.cxx @@ -1909,7 +1909,7 @@ static void addPadding(char *string, int startIndent, int toIndent, if (useTabs) { while (indent < toIndent) { - static char t = '\t'; + //static char t = '\t'; len = Fl_Text_Buffer::character_width("\t", indent, tabDist); if (len > 1 && indent + len <= toIndent) { *outPtr++ = '\t'; diff --git a/src/Fl_Tree.cxx b/src/Fl_Tree.cxx index 25d509c97..54b56ee63 100644 --- a/src/Fl_Tree.cxx +++ b/src/Fl_Tree.cxx @@ -7,6 +7,7 @@ #include <string.h> #include <FL/Fl_Tree.H> +#include <FL/Fl_Preferences.H> #define SCROLL_W 15 @@ -426,6 +427,56 @@ int Fl_Tree::select_only(Fl_Tree_Item *selitem, int docallback) { return(changed); } +/** + * Read a preferences database into the tree widget. + * A preferences database is a hierarchical collection of data which can be + * directly loaded into the tree view for inspection. + * \param[in] prefs the Fl_Preferences database + */ +void Fl_Tree::load(Fl_Preferences &prefs) +{ + int i, j, n, pn = strlen(prefs.path()); + char *p; + const char *path = prefs.path(); + if (strcmp(path, ".")==0) + path += 1; // root path is empty + else + path += 2; // child path starts with "./" + n = prefs.groups(); + for (i=0; i<n; i++) { + Fl_Preferences prefsChild(prefs, i); + add(prefsChild.path()+2); // children always start with "./" + load(prefsChild); + } + n = prefs.entries(); + for (i=0; i<n; i++) { + // We must remove all fwd slashes in the key and value strings. Replace with backslash. + char *key = strdup(prefs.entry(i)); + int kn = strlen(key); + for (j=0; j<kn; j++) { + if (key[j]=='/') key[j]='\\'; + } + char *val; prefs.get(key, val, ""); + int vn = strlen(val); + for (j=0; j<vn; j++) { + if (val[j]=='/') val[j]='\\'; + } + if (vn<40) { + int sze = pn + strlen(key) + vn; + p = (char*)malloc(sze+5); + sprintf(p, "%s/%s = %s", path, key, val); + } else { + int sze = pn + strlen(key) + 40; + p = (char*)malloc(sze+5); + sprintf(p, "%s/%s = %.40s...", path, key, val); + } + add(p[0]=='/'?p+1:p); + free(p); + free(val); + free(key); + } +} + // // End of "$Id$". // diff --git a/src/Fl_Tree_Item.cxx b/src/Fl_Tree_Item.cxx index 18a1cfac4..24f33cd2c 100644 --- a/src/Fl_Tree_Item.cxx +++ b/src/Fl_Tree_Item.cxx @@ -481,6 +481,11 @@ void Fl_Tree_Item::draw(int X, int &Y, int W, Fl_Widget *tree, int H = _labelsize; if(usericon() && H < usericon()->h()) H = usericon()->h(); H += prefs.linespacing() + fl_descent(); + // adjust horizontally if we draw no connecting lines + if ( is_root() && prefs.connectorstyle() == FL_TREE_CONNECTOR_NONE ) { + X -= prefs.openicon()->w(); + W += prefs.openicon()->w(); + } // Colors, fonts Fl_Color fg = _selected ? prefs.bgcolor() : _labelfgcolor; Fl_Color bg = _selected ? prefs.selectcolor() : _labelbgcolor; @@ -497,9 +502,9 @@ void Fl_Tree_Item::draw(int X, int &Y, int W, Fl_Widget *tree, int textw=0, texth=0; fl_measure(_label, textw, texth, 0); int textycenter = Y+(H/2); - int &icon_x = _collapse_xywh[0] = X-1; - int &icon_y = _collapse_xywh[1] = textycenter - (prefs.openicon()->h()/2); int &icon_w = _collapse_xywh[2] = prefs.openicon()->w(); + int &icon_x = _collapse_xywh[0] = X + (icon_w + prefs.connectorwidth())/2 - 3; + int &icon_y = _collapse_xywh[1] = textycenter - (prefs.openicon()->h()/2); _collapse_xywh[3] = prefs.openicon()->h(); // Horizontal connector values int hstartx = X+icon_w/2-1; @@ -514,7 +519,11 @@ void Fl_Tree_Item::draw(int X, int &Y, int W, Fl_Widget *tree, // Draw connectors if ( prefs.connectorstyle() != FL_TREE_CONNECTOR_NONE ) { // Horiz connector between center of icon and text - draw_horizontal_connector(hstartx, hendx, textycenter, prefs); + // if this is root, the connector should not dangle in thin air on the left + if (is_root()) + draw_horizontal_connector(hcenterx, hendx, textycenter, prefs); + else + draw_horizontal_connector(hstartx, hendx, textycenter, prefs); if ( has_children() && is_open() ) { // Small vertical line down to children draw_vertical_connector(hcenterx, textycenter, Y+H, prefs); @@ -538,9 +547,11 @@ void Fl_Tree_Item::draw(int X, int &Y, int W, Fl_Widget *tree, } } // Background for this item - int &bx = _label_xywh[0] = X+(icon_w/2-1+prefs.connectorwidth()); + int cw1 = icon_w+prefs.connectorwidth()/2, cw2 = prefs.connectorwidth(); + int cwidth = cw1>cw2 ? cw1 : cw2; + int &bx = _label_xywh[0] = X+(icon_w/2-1+cwidth); int &by = _label_xywh[1] = Y; - int &bw = _label_xywh[2] = W-(icon_w/2-1+prefs.connectorwidth()); + int &bw = _label_xywh[2] = W-(icon_w/2-1+cwidth); int &bh = _label_xywh[3] = H; // Draw bg only if different from tree's bg if ( bg != tree->color() || is_selected() ) { @@ -554,7 +565,7 @@ void Fl_Tree_Item::draw(int X, int &Y, int W, Fl_Widget *tree, } } // Draw user icon (if any) - int useroff = (icon_w/2-1+prefs.connectorwidth()); + int useroff = (icon_w/2-1+cwidth); if ( usericon() ) { // Item has user icon? Use it useroff += prefs.usericonmarginleft(); diff --git a/src/Fl_Tree_Prefs.cxx b/src/Fl_Tree_Prefs.cxx index 4adee203d..04afda404 100644 --- a/src/Fl_Tree_Prefs.cxx +++ b/src/Fl_Tree_Prefs.cxx @@ -34,6 +34,22 @@ // These can be replaced via prefs.openicon()/closeicon() // static const char *L_open_xpm[] = { +#ifdef __APPLE__ + "11 11 2 1", + ". c None", + "@ c #000000", + "...@.......", + "...@@......", + "...@@@.....", + "...@@@@....", + "...@@@@@...", + "...@@@@@@..", + "...@@@@@...", + "...@@@@....", + "...@@@.....", + "...@@......", + "...@......." +#else "11 11 3 1", ". c #fefefe", "# c #444444", @@ -48,10 +64,28 @@ static const char *L_open_xpm[] = { "#....@....#", "#.........#", "#.........#", - "###########"}; + "###########" +#endif +}; static Fl_Pixmap L_openpixmap(L_open_xpm); static const char *L_close_xpm[] = { +#ifdef __APPLE__ + "11 11 2 1", + ". c None", + "@ c #000000", + "...........", + "...........", + "...........", + "...........", + "...........", + "@@@@@@@@@@@", + ".@@@@@@@@@.", + "..@@@@@@@..", + "...@@@@@...", + "....@@@....", + ".....@....." +#else "11 11 3 1", ". c #fefefe", "# c #444444", @@ -66,7 +100,9 @@ static const char *L_close_xpm[] = { "#.........#", "#.........#", "#.........#", - "###########"}; + "###########" +#endif +}; static Fl_Pixmap L_closepixmap(L_close_xpm); /// Sets the default icon to be used as the 'open' icon @@ -105,7 +141,11 @@ Fl_Tree_Prefs::Fl_Tree_Prefs() { _selectcolor = FL_DARK_BLUE; _inactivecolor = FL_GRAY; _connectorcolor = Fl_Color(43); +#ifdef __APPLE__ + _connectorstyle = FL_TREE_CONNECTOR_NONE; +#else _connectorstyle = FL_TREE_CONNECTOR_DOTTED; +#endif _openimage = &L_openpixmap; _closeimage = &L_closepixmap; _userimage = 0; diff --git a/test/demo.cxx b/test/demo.cxx index 221f47eb8..cca6243de 100644 --- a/test/demo.cxx +++ b/test/demo.cxx @@ -92,7 +92,7 @@ const char *default_menu[] = { "@e:Block\\nAttack!:blocks\n", "@e:Checkers:checkers\n", "@e:Sudoku:sudoku\n", - "@e:Print\nsupport:device\n", + "@e:Print\\nsupport:device\n", "\n", "@main:Other\\nTests:@o\n", "@o:Color Choosers:color_chooser\n", diff --git a/test/tree.cxx b/test/tree.cxx index 580794165..fbecc7be1 100644 --- a/test/tree.cxx +++ b/test/tree.cxx @@ -218,6 +218,23 @@ Fl_Choice *collapseicons_chooser=(Fl_Choice *)0; static void cb_collapseicons_chooser(Fl_Choice*, void*) { static const char *L_open_xpm[] = { +#ifdef __APPLE__ + "11 11 3 1", + ". c #fefefe", + "# c #444444", + "@ c #000000", + "###########", + "#.........#", + "#.........#", + "#....@....#", + "#....@....#", + "#..@@@@@..#", + "#....@....#", + "#....@....#", + "#.........#", + "#.........#", + "###########" +#else "11 11 2 1", ". c None", "@ c #000000", @@ -231,10 +248,29 @@ static void cb_collapseicons_chooser(Fl_Choice*, void*) { "...@@@@....", "...@@@.....", "...@@......", - "...@......."}; + "...@......." +#endif + }; static Fl_Pixmap L_openpixmap(L_open_xpm); static const char *L_close_xpm[] = { +#ifdef __APPLE__ + "11 11 3 1", + ". c #fefefe", + "# c #444444", + "@ c #000000", + "###########", + "#.........#", + "#.........#", + "#.........#", + "#.........#", + "#..@@@@@..#", + "#.........#", + "#.........#", + "#.........#", + "#.........#", + "###########" +#else "11 11 2 1", ". c None", "@ c #000000", @@ -248,7 +284,9 @@ static const char *L_close_xpm[] = { "..@@@@@@@..", "...@@@@@...", "....@@@....", - ".....@....."}; + ".....@....." +#endif + }; static Fl_Pixmap L_closepixmap(L_close_xpm); switch ( collapseicons_chooser->value() ) { @@ -270,7 +308,7 @@ switch ( collapseicons_chooser->value() ) { Fl_Menu_Item menu_collapseicons_chooser[] = { {"Normal", 0, 0, 0, 0, FL_NORMAL_LABEL, 0, 11, 0}, - {"Arrow", 0, 0, 0, 0, FL_NORMAL_LABEL, 0, 11, 0}, + {"Custom", 0, 0, 0, 0, FL_NORMAL_LABEL, 0, 11, 0}, {"Off", 0, 0, 0, 0, FL_NORMAL_LABEL, 0, 11, 0}, {0,0,0,0,0,0,0,0,0} }; @@ -519,6 +557,18 @@ static void cb_clearall_button(Fl_Button*, void*) { tree->redraw(); } +Fl_Button *loaddb_button=(Fl_Button *)0; + +static void cb_loaddb_button(Fl_Button*, void*) { + const char *filename = fl_file_chooser("Select a Preferences style Databse", "Preferences(*.prefs)", 0L); +if (filename) { + tree->clear(); + Fl_Preferences prefs(filename, 0L, 0L); + tree->load(prefs); + tree->redraw(); +}; +} + int main(int argc, char **argv) { { window = new Fl_Double_Window(580, 695, "tree"); { tree = new Fl_Tree(15, 15, 550, 390); @@ -538,7 +588,6 @@ int main(int argc, char **argv) { margintop_slider->tooltip("Changes the top margin for the tree widget"); margintop_slider->type(1); margintop_slider->labelsize(12); - margintop_slider->step(0.01); margintop_slider->textsize(12); margintop_slider->callback((Fl_Callback*)cb_margintop_slider, (void*)(tree)); margintop_slider->align(Fl_Align(FL_ALIGN_LEFT)); @@ -551,7 +600,6 @@ int main(int argc, char **argv) { marginleft_slider->tooltip("Changes the left margin for the tree widget"); marginleft_slider->type(1); marginleft_slider->labelsize(12); - marginleft_slider->step(0.01); marginleft_slider->textsize(12); marginleft_slider->callback((Fl_Callback*)cb_marginleft_slider, (void*)(tree)); marginleft_slider->align(Fl_Align(FL_ALIGN_LEFT)); @@ -564,7 +612,6 @@ int main(int argc, char **argv) { openchild_marginbottom_slider->tooltip("Changes the vertical space below an open child tree"); openchild_marginbottom_slider->type(1); openchild_marginbottom_slider->labelsize(12); - openchild_marginbottom_slider->step(0.01); openchild_marginbottom_slider->textsize(12); openchild_marginbottom_slider->callback((Fl_Callback*)cb_openchild_marginbottom_slider, (void*)(tree)); openchild_marginbottom_slider->align(Fl_Align(FL_ALIGN_LEFT)); @@ -578,7 +625,6 @@ int main(int argc, char **argv) { d"); labelsize_slider->type(1); labelsize_slider->labelsize(12); - labelsize_slider->step(0.01); labelsize_slider->textsize(12); labelsize_slider->callback((Fl_Callback*)cb_labelsize_slider, (void*)(tree)); labelsize_slider->align(Fl_Align(FL_ALIGN_LEFT)); @@ -591,29 +637,28 @@ d"); connectorwidth_slider->tooltip("Tests Fl_Tree::connectorwidth()"); connectorwidth_slider->type(1); connectorwidth_slider->labelsize(12); - connectorwidth_slider->step(0.01); connectorwidth_slider->textsize(12); connectorwidth_slider->callback((Fl_Callback*)cb_connectorwidth_slider, (void*)(tree)); connectorwidth_slider->align(Fl_Align(FL_ALIGN_LEFT)); o->value(tree->connectorwidth()); - o->range(10.0, 100.0); + o->range(1.0, 100.0); o->step(1.0); o->color(46); o->selection_color(FL_RED); } // Fl_Value_Slider* connectorwidth_slider - { usericon_radio = new Fl_Check_Button(145, 520, 130, 16, "Enable user icons?"); + { usericon_radio = new Fl_Check_Button(145, 525, 130, 16, "Enable user icons?"); usericon_radio->tooltip("Tests Fl_Tree_Item::usericon()"); usericon_radio->down_box(FL_DOWN_BOX); usericon_radio->labelsize(11); usericon_radio->callback((Fl_Callback*)cb_usericon_radio, (void*)(tree)); } // Fl_Check_Button* usericon_radio - { showroot_radio = new Fl_Check_Button(145, 539, 130, 16, "Show root?"); + { showroot_radio = new Fl_Check_Button(145, 544, 130, 16, "Show root?"); showroot_radio->tooltip("Tests Fl_Tree_Item::usericon()"); showroot_radio->down_box(FL_DOWN_BOX); showroot_radio->labelsize(11); showroot_radio->callback((Fl_Callback*)cb_showroot_radio, (void*)(tree)); int onoff = tree->showroot(); showroot_radio->value(onoff); } // Fl_Check_Button* showroot_radio - { collapseicons_chooser = new Fl_Choice(145, 564, 110, 16, "Collapse icons"); + { collapseicons_chooser = new Fl_Choice(145, 572, 110, 16, "Collapse icons"); collapseicons_chooser->tooltip("Tests Fl_Tree::openicon() and Fl_Tree::closeicon()"); collapseicons_chooser->down_box(FL_BORDER_BOX); collapseicons_chooser->labelsize(11); @@ -621,16 +666,16 @@ d"); collapseicons_chooser->callback((Fl_Callback*)cb_collapseicons_chooser); collapseicons_chooser->menu(menu_collapseicons_chooser); } // Fl_Choice* collapseicons_chooser - { connectorstyle_chooser = new Fl_Choice(145, 584, 110, 16, "Line style"); + { connectorstyle_chooser = new Fl_Choice(145, 592, 110, 16, "Line style"); connectorstyle_chooser->tooltip("Tests connectorstyle() bit flags"); connectorstyle_chooser->down_box(FL_BORDER_BOX); connectorstyle_chooser->labelsize(11); connectorstyle_chooser->textsize(11); connectorstyle_chooser->callback((Fl_Callback*)cb_connectorstyle_chooser); connectorstyle_chooser->menu(menu_connectorstyle_chooser); - connectorstyle_chooser->value(1); // tree's default is 'dotted' + switch (tree->connectorstyle()) { case FL_TREE_CONNECTOR_NONE: connectorstyle_chooser->value(0); break; case FL_TREE_CONNECTOR_DOTTED: connectorstyle_chooser->value(1); break; case FL_TREE_CONNECTOR_SOLID: connectorstyle_chooser->value(2); break; } } // Fl_Choice* connectorstyle_chooser - { labelcolor_chooser = new Fl_Choice(145, 604, 110, 16, "Item Text Color"); + { labelcolor_chooser = new Fl_Choice(145, 612, 110, 16, "Item Text Color"); labelcolor_chooser->tooltip("Changes the label color for the selected items\nIf no items selected, all are\ changed"); labelcolor_chooser->down_box(FL_BORDER_BOX); @@ -639,7 +684,7 @@ d"); labelcolor_chooser->callback((Fl_Callback*)cb_labelcolor_chooser); labelcolor_chooser->menu(menu_labelcolor_chooser); } // Fl_Choice* labelcolor_chooser - { selectmode_chooser = new Fl_Choice(145, 624, 110, 16, "Selection Mode"); + { selectmode_chooser = new Fl_Choice(145, 632, 110, 16, "Selection Mode"); selectmode_chooser->tooltip("Sets how Fl_Tree handles mouse selection of tree items"); selectmode_chooser->down_box(FL_BORDER_BOX); selectmode_chooser->labelsize(11); @@ -649,7 +694,7 @@ d"); selectmode_chooser->value(1); cb_selectmode_chooser(selectmode_chooser, (void*)0); } // Fl_Choice* selectmode_chooser - { whenmode_chooser = new Fl_Choice(145, 644, 110, 16, "When"); + { whenmode_chooser = new Fl_Choice(145, 652, 110, 16, "When"); whenmode_chooser->tooltip("Sets when() the tree\'s callback is invoked"); whenmode_chooser->down_box(FL_BORDER_BOX); whenmode_chooser->labelsize(11); @@ -688,37 +733,42 @@ d"); bbbchild02select_toggle->labelsize(11); bbbchild02select_toggle->callback((Fl_Callback*)cb_bbbchild02select_toggle); } // Fl_Light_Button* bbbchild02select_toggle - { deactivate_toggle = new Fl_Light_Button(280, 625, 90, 16, " Deactivate"); + { deactivate_toggle = new Fl_Light_Button(280, 633, 90, 16, " Deactivate"); deactivate_toggle->tooltip("Toggle the deactivation state of the selected items.\nIf none are selected, a\ ll are set."); deactivate_toggle->labelsize(11); deactivate_toggle->callback((Fl_Callback*)cb_deactivate_toggle); } // Fl_Light_Button* deactivate_toggle - { bold_toggle = new Fl_Light_Button(280, 644, 90, 16, " Bold Font"); + { bold_toggle = new Fl_Light_Button(280, 652, 90, 16, " Bold Font"); bold_toggle->tooltip("Toggles bold font for selected items\nIf nothing selected, all are changed"); bold_toggle->labelsize(11); bold_toggle->callback((Fl_Callback*)cb_bold_toggle); } // Fl_Light_Button* bold_toggle - { insertabove_button = new Fl_Button(380, 624, 90, 16, "Insert Above"); + { insertabove_button = new Fl_Button(380, 632, 90, 16, "Insert Above"); insertabove_button->tooltip("Inserts three items above the selected items"); insertabove_button->labelsize(11); insertabove_button->callback((Fl_Callback*)cb_insertabove_button); } // Fl_Button* insertabove_button - { rebuildtree_button = new Fl_Button(380, 644, 90, 16, "Rebuild Tree"); + { rebuildtree_button = new Fl_Button(380, 652, 90, 16, "Rebuild Tree"); rebuildtree_button->tooltip("Rebuilds the tree with defaults"); rebuildtree_button->labelsize(11); rebuildtree_button->callback((Fl_Callback*)cb_rebuildtree_button); } // Fl_Button* rebuildtree_button - { clearselected_button = new Fl_Button(475, 624, 90, 16, "Clear Selected"); + { clearselected_button = new Fl_Button(475, 632, 90, 16, "Clear Selected"); clearselected_button->tooltip("Clears the selected items"); clearselected_button->labelsize(11); clearselected_button->callback((Fl_Callback*)cb_clearselected_button); } // Fl_Button* clearselected_button - { clearall_button = new Fl_Button(475, 644, 90, 16, "Clear All"); + { clearall_button = new Fl_Button(475, 652, 90, 16, "Clear All"); clearall_button->tooltip("Clears all items\nTests Fl_Tree::clear()"); clearall_button->labelsize(11); clearall_button->callback((Fl_Callback*)cb_clearall_button); } // Fl_Button* clearall_button + { loaddb_button = new Fl_Button(380, 612, 90, 16, "Load Database..."); + loaddb_button->tooltip("Load the contents of an Fl_Preferences databse into the tree view"); + loaddb_button->labelsize(11); + loaddb_button->callback((Fl_Callback*)cb_loaddb_button); + } // Fl_Button* loaddb_button window->end(); } // Fl_Double_Window* window // Initialize Tree diff --git a/test/tree.fl b/test/tree.fl index a5070891a..9e70d00dd 100644 --- a/test/tree.fl +++ b/test/tree.fl @@ -20,7 +20,13 @@ decl {\#include <FL/Fl_Tree.H>} {public global decl {\#include <FL/fl_ask.H>} {public global } -Function {Button_CB(Fl_Widget*w, void*data)} {open return_type void +decl {\#include <FL/Fl_File_Chooser.H>} {selected public global +} + +decl {\#include <FL/Fl_Preferences.H>} {public global +} + +Function {Button_CB(Fl_Widget*w, void*data)} {return_type void } { code {fprintf(stderr, "'%s' button pushed\\n", w->label());} {} } @@ -109,7 +115,7 @@ Function {} {open } { Fl_Window window { label tree open - xywh {1105 30 580 695} type Double visible + xywh {1105 44 580 695} type Double visible } { Fl_Group tree { user_data 1234 @@ -130,7 +136,7 @@ if ( item ) { callback {int val = (int)margintop_slider->value(); tree->margintop(val); tree->redraw();} - tooltip {Changes the top margin for the tree widget} xywh {190 414 240 16} type Horizontal labelsize 12 align 4 step 0.01 textsize 12 + tooltip {Changes the top margin for the tree widget} xywh {190 414 240 16} type Horizontal labelsize 12 align 4 textsize 12 code0 {o->value(tree->margintop());} code1 {o->range(0.0, 100.0);} code2 {o->step(1.0);} @@ -142,7 +148,7 @@ tree->redraw();} callback {int val = (int)marginleft_slider->value(); tree->marginleft(val); tree->redraw();} - tooltip {Changes the left margin for the tree widget} xywh {190 434 240 16} type Horizontal labelsize 12 align 4 step 0.01 textsize 12 + tooltip {Changes the left margin for the tree widget} xywh {190 434 240 16} type Horizontal labelsize 12 align 4 textsize 12 code0 {o->value(tree->marginleft());} code1 {o->range(0.0, 100.0);} code2 {o->step(1.0);} @@ -154,7 +160,7 @@ tree->redraw();} callback {int val = (int)openchild_marginbottom_slider->value(); tree->openchild_marginbottom(val); tree->redraw();} - tooltip {Changes the vertical space below an open child tree} xywh {190 454 240 16} type Horizontal labelsize 12 align 4 step 0.01 textsize 12 + tooltip {Changes the vertical space below an open child tree} xywh {190 454 240 16} type Horizontal labelsize 12 align 4 textsize 12 code0 {o->value(tree->openchild_marginbottom());} code1 {o->range(0.0, 100.0);} code2 {o->step(1.0);} @@ -183,7 +189,7 @@ if ( ! count ) { tree->redraw();} tooltip {Changes the font size of the selected items -If none selected, all are changed} xywh {190 474 240 16} type Horizontal labelsize 12 align 4 step 0.01 textsize 12 +If none selected, all are changed} xywh {190 474 240 16} type Horizontal labelsize 12 align 4 textsize 12 code0 {o->value(tree->labelsize());} code1 {o->range(5.0, 200.0);} code2 {o->step(1.0);} @@ -193,9 +199,9 @@ If none selected, all are changed} xywh {190 474 240 16} type Horizontal labelsi label {Connector width} user_data tree callback {tree->connectorwidth((int)connectorwidth_slider->value());} - tooltip {Tests Fl_Tree::connectorwidth()} xywh {190 494 240 16} type Horizontal labelsize 12 align 4 step 0.01 textsize 12 + tooltip {Tests Fl_Tree::connectorwidth()} xywh {190 494 240 16} type Horizontal labelsize 12 align 4 textsize 12 code0 {o->value(tree->connectorwidth());} - code1 {o->range(10.0, 100.0);} + code1 {o->range(1.0, 100.0);} code2 {o->step(1.0);} code3 {o->color(46); o->selection_color(FL_RED);} } @@ -250,19 +256,36 @@ if ( usericon_radio->value() ) { if ( ( i = tree->find_item("Bbb/bgb/222") ) != NULL ) i->usericon(0); if ( ( i = tree->find_item("Bbb/bgb/333") ) != NULL ) i->usericon(0); }} - tooltip {Tests Fl_Tree_Item::usericon()} xywh {145 520 130 16} down_box DOWN_BOX labelsize 11 + tooltip {Tests Fl_Tree_Item::usericon()} xywh {145 525 130 16} down_box DOWN_BOX labelsize 11 } Fl_Check_Button showroot_radio { label {Show root?} user_data tree callback {int onoff = showroot_radio->value(); tree->showroot(onoff);} - tooltip {Tests Fl_Tree_Item::usericon()} xywh {145 539 130 16} down_box DOWN_BOX labelsize 11 + tooltip {Tests Fl_Tree_Item::usericon()} xywh {145 544 130 16} down_box DOWN_BOX labelsize 11 code0 {int onoff = tree->showroot(); showroot_radio->value(onoff);} } Fl_Choice collapseicons_chooser { label {Collapse icons} callback {static const char *L_open_xpm[] = { +\#ifdef __APPLE__ + "11 11 3 1", + ". c \#fefefe", + "\# c \#444444", + "@ c \#000000", + "\#\#\#\#\#\#\#\#\#\#\#", + "\#.........\#", + "\#.........\#", + "\#....@....\#", + "\#....@....\#", + "\#..@@@@@..\#", + "\#....@....\#", + "\#....@....\#", + "\#.........\#", + "\#.........\#", + "\#\#\#\#\#\#\#\#\#\#\#" +\#else "11 11 2 1", ". c None", "@ c \#000000", @@ -276,10 +299,29 @@ tree->showroot(onoff);} "...@@@@....", "...@@@.....", "...@@......", - "...@......."}; + "...@......." +\#endif + }; static Fl_Pixmap L_openpixmap(L_open_xpm); static const char *L_close_xpm[] = { +\#ifdef __APPLE__ + "11 11 3 1", + ". c \#fefefe", + "\# c \#444444", + "@ c \#000000", + "\#\#\#\#\#\#\#\#\#\#\#", + "\#.........\#", + "\#.........\#", + "\#.........\#", + "\#.........\#", + "\#..@@@@@..\#", + "\#.........\#", + "\#.........\#", + "\#.........\#", + "\#.........\#", + "\#\#\#\#\#\#\#\#\#\#\#" +\#else "11 11 2 1", ". c None", "@ c \#000000", @@ -293,7 +335,9 @@ static const char *L_close_xpm[] = { "..@@@@@@@..", "...@@@@@...", "....@@@....", - ".....@....."}; + ".....@....." +\#endif + }; static Fl_Pixmap L_closepixmap(L_close_xpm); switch ( collapseicons_chooser->value() ) { @@ -311,14 +355,14 @@ switch ( collapseicons_chooser->value() ) { tree->showcollapse(0); break; }} open - tooltip {Tests Fl_Tree::openicon() and Fl_Tree::closeicon()} xywh {145 564 110 16} down_box BORDER_BOX labelsize 11 textsize 11 + tooltip {Tests Fl_Tree::openicon() and Fl_Tree::closeicon()} xywh {145 572 110 16} down_box BORDER_BOX labelsize 11 textsize 11 } { MenuItem {} { label Normal xywh {0 0 36 21} labelsize 11 } MenuItem {} { - label Arrow + label Custom xywh {10 10 36 21} labelsize 11 } MenuItem {} { @@ -334,8 +378,8 @@ switch ( connectorstyle_chooser->value() ) { case 1: tree->connectorstyle(FL_TREE_CONNECTOR_DOTTED); break; case 2: tree->connectorstyle(FL_TREE_CONNECTOR_SOLID); break; }} open - tooltip {Tests connectorstyle() bit flags} xywh {145 584 110 16} down_box BORDER_BOX labelsize 11 textsize 11 - code0 {connectorstyle_chooser->value(1); // tree's default is 'dotted'} + tooltip {Tests connectorstyle() bit flags} xywh {145 592 110 16} down_box BORDER_BOX labelsize 11 textsize 11 + code0 {switch (tree->connectorstyle()) { case FL_TREE_CONNECTOR_NONE: connectorstyle_chooser->value(0); break; case FL_TREE_CONNECTOR_DOTTED: connectorstyle_chooser->value(1); break; case FL_TREE_CONNECTOR_SOLID: connectorstyle_chooser->value(2); break; }} } { MenuItem {} { label None @@ -380,7 +424,7 @@ if ( ! count ) { tree->redraw();} open tooltip {Changes the label color for the selected items -If no items selected, all are changed} xywh {145 604 110 16} down_box BORDER_BOX labelsize 11 textsize 11 +If no items selected, all are changed} xywh {145 612 110 16} down_box BORDER_BOX labelsize 11 textsize 11 } { MenuItem {} { label Black @@ -408,7 +452,7 @@ switch ( selectmode_chooser->value() ) { case 2: tree->selectmode(FL_TREE_SELECT_MULTI); break; // Multi default: tree->selectmode(FL_TREE_SELECT_SINGLE); break; // Single }} - tooltip {Sets how Fl_Tree handles mouse selection of tree items} xywh {145 624 110 16} down_box BORDER_BOX labelsize 11 textsize 11 + tooltip {Sets how Fl_Tree handles mouse selection of tree items} xywh {145 632 110 16} down_box BORDER_BOX labelsize 11 textsize 11 code0 {selectmode_chooser->value(1);} code1 {cb_selectmode_chooser(selectmode_chooser, (void*)0);} } { @@ -434,7 +478,7 @@ switch ( whenmode_chooser->value() ) { case 2: tree->when(FL_WHEN_NEVER); break; default: tree->when(FL_WHEN_RELEASE); break; }} - tooltip {Sets when() the tree's callback is invoked} xywh {145 644 110 16} down_box BORDER_BOX labelsize 11 textsize 11 + tooltip {Sets when() the tree's callback is invoked} xywh {145 652 110 16} down_box BORDER_BOX labelsize 11 textsize 11 code0 {whenmode_chooser->value(1);} code1 {cb_whenmode_chooser(whenmode_chooser, (void*)0);} } { @@ -527,7 +571,7 @@ if ( count == 0 ) { tree->redraw();} tooltip {Toggle the deactivation state of the selected items. -If none are selected, all are set.} xywh {280 625 90 16} labelsize 11 +If none are selected, all are set.} xywh {280 633 90 16} labelsize 11 } Fl_Light_Button bold_toggle { label { Bold Font} @@ -551,7 +595,7 @@ if ( ! count ) { tree->redraw();} tooltip {Toggles bold font for selected items -If nothing selected, all are changed} xywh {280 644 90 16} labelsize 11 +If nothing selected, all are changed} xywh {280 652 90 16} labelsize 11 } Fl_Button insertabove_button { label {Insert Above} @@ -566,12 +610,12 @@ while (item) { } tree->redraw();} - tooltip {Inserts three items above the selected items} xywh {380 624 90 16} labelsize 11 + tooltip {Inserts three items above the selected items} xywh {380 632 90 16} labelsize 11 } Fl_Button rebuildtree_button { label {Rebuild Tree} callback {RebuildTree();} - tooltip {Rebuilds the tree with defaults} xywh {380 644 90 16} labelsize 11 + tooltip {Rebuilds the tree with defaults} xywh {380 652 90 16} labelsize 11 } Fl_Button clearselected_button { label {Clear Selected} @@ -586,14 +630,25 @@ while (item) { } tree->redraw();} - tooltip {Clears the selected items} xywh {475 624 90 16} labelsize 11 + tooltip {Clears the selected items} xywh {475 632 90 16} labelsize 11 } Fl_Button clearall_button { label {Clear All} callback {tree->clear(); -tree->redraw();} selected +tree->redraw();} tooltip {Clears all items -Tests Fl_Tree::clear()} xywh {475 644 90 16} labelsize 11 +Tests Fl_Tree::clear()} xywh {475 652 90 16} labelsize 11 + } + Fl_Button loaddb_button { + label {Load Database...} + callback {const char *filename = fl_file_chooser("Select a Preferences style Databse", "Preferences(*.prefs)", 0L); +if (filename) { + tree->clear(); + Fl_Preferences prefs(filename, 0L, 0L); + tree->load(prefs); + tree->redraw(); +}} + tooltip {Load the contents of an Fl_Preferences databse into the tree view} xywh {380 612 90 16} labelsize 11 } } code {// Initialize Tree diff --git a/test/tree.h b/test/tree.h index e479bff11..c25437b93 100644 --- a/test/tree.h +++ b/test/tree.h @@ -9,6 +9,8 @@ #include <FL/Fl_Group.H> #include <FL/Fl_Tree.H> #include <FL/fl_ask.H> +#include <FL/Fl_File_Chooser.H> +#include <FL/Fl_Preferences.H> void Button_CB(Fl_Widget*w, void*data); void RebuildTree(); #include <FL/Fl_Double_Window.H> @@ -44,6 +46,7 @@ extern Fl_Button *insertabove_button; extern Fl_Button *rebuildtree_button; extern Fl_Button *clearselected_button; extern Fl_Button *clearall_button; +extern Fl_Button *loaddb_button; extern Fl_Menu_Item menu_collapseicons_chooser[]; extern Fl_Menu_Item menu_connectorstyle_chooser[]; extern Fl_Menu_Item menu_labelcolor_chooser[]; |
