summaryrefslogtreecommitdiff
path: root/src/Fl_Tree_Prefs.cxx
diff options
context:
space:
mode:
authorMatthias Melcher <fltk@matthiasm.com>2010-07-10 09:44:45 +0000
committerMatthias Melcher <fltk@matthiasm.com>2010-07-10 09:44:45 +0000
commit32716d6b1e8a90cbe61b60994323029ec6abe85c (patch)
tree9c047f9cbf6a6581ef408dfabdab0aebde240a1b /src/Fl_Tree_Prefs.cxx
parent8306c3d0b31d4e60a9ba9c4d0ca4ed6a32226de1 (diff)
Updated the Fluid IDE support for the current source file structure. Changed the Fl_Tree rendering code around a bit to make the tree more like MSWindows on Windows and more like Apple on Apple machines. I hope you guys like it. I also moved the function to load Fl_Preferences into an Fl_Tree into the Fl_Tree class where it belongs.
git-svn-id: file:///fltk/svn/fltk/branches/branch-1.3@7672 ea41ed52-d2ee-0310-a9c1-e6b18d33e121
Diffstat (limited to 'src/Fl_Tree_Prefs.cxx')
-rw-r--r--src/Fl_Tree_Prefs.cxx44
1 files changed, 42 insertions, 2 deletions
diff --git a/src/Fl_Tree_Prefs.cxx b/src/Fl_Tree_Prefs.cxx
index 4adee203d..04afda404 100644
--- a/src/Fl_Tree_Prefs.cxx
+++ b/src/Fl_Tree_Prefs.cxx
@@ -34,6 +34,22 @@
// These can be replaced via prefs.openicon()/closeicon()
//
static const char *L_open_xpm[] = {
+#ifdef __APPLE__
+ "11 11 2 1",
+ ". c None",
+ "@ c #000000",
+ "...@.......",
+ "...@@......",
+ "...@@@.....",
+ "...@@@@....",
+ "...@@@@@...",
+ "...@@@@@@..",
+ "...@@@@@...",
+ "...@@@@....",
+ "...@@@.....",
+ "...@@......",
+ "...@......."
+#else
"11 11 3 1",
". c #fefefe",
"# c #444444",
@@ -48,10 +64,28 @@ static const char *L_open_xpm[] = {
"#....@....#",
"#.........#",
"#.........#",
- "###########"};
+ "###########"
+#endif
+};
static Fl_Pixmap L_openpixmap(L_open_xpm);
static const char *L_close_xpm[] = {
+#ifdef __APPLE__
+ "11 11 2 1",
+ ". c None",
+ "@ c #000000",
+ "...........",
+ "...........",
+ "...........",
+ "...........",
+ "...........",
+ "@@@@@@@@@@@",
+ ".@@@@@@@@@.",
+ "..@@@@@@@..",
+ "...@@@@@...",
+ "....@@@....",
+ ".....@....."
+#else
"11 11 3 1",
". c #fefefe",
"# c #444444",
@@ -66,7 +100,9 @@ static const char *L_close_xpm[] = {
"#.........#",
"#.........#",
"#.........#",
- "###########"};
+ "###########"
+#endif
+};
static Fl_Pixmap L_closepixmap(L_close_xpm);
/// Sets the default icon to be used as the 'open' icon
@@ -105,7 +141,11 @@ Fl_Tree_Prefs::Fl_Tree_Prefs() {
_selectcolor = FL_DARK_BLUE;
_inactivecolor = FL_GRAY;
_connectorcolor = Fl_Color(43);
+#ifdef __APPLE__
+ _connectorstyle = FL_TREE_CONNECTOR_NONE;
+#else
_connectorstyle = FL_TREE_CONNECTOR_DOTTED;
+#endif
_openimage = &L_openpixmap;
_closeimage = &L_closepixmap;
_userimage = 0;